| Compound Information | SONAR Target prediction | | Name: | Furosemide | | Unique Identifier: | LOPAC 00044 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C12ClH11N2O5S | | Molecular Weight: | 319.658 g/mol | | X log p: | 9.278 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.81 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | NS(=O)Oc1cc(C(O)=O)c(NCc2occc2)cc1Cl | | Class: | Ion Pump | | Action: | Inhibitor | | Selectivity: | Na+,K+,Cl- cotransport |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7962±0.0795512 |
| Normalized OD Score: sc h |
0.9774±0.0242033 |
| Z-Score: |
-0.6854±0.709585 |
| p-Value: |
0.51494 |
| Z-Factor: |
-44.4989 |
| Fitness Defect: |
0.6637 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 7|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04673125000000002±0.00247 | | Plate DMSO Control (-): | 0.7753±0.04573 | | Plate Z-Factor: | 0.8612 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 6603849 |
4-chloro-2-(2-furylmethylamino)-5-sulfinamoyloxy-benzoic acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7895 | Additional Members: 8 | Rows returned: 0 | |
|
